About 3-amino-2,3-dimethylbutan-2-ol;2-ethyl-2-propan-2-ylpropanedioic acid
3-amino-2,3-dimethylbutan-2-ol;2-ethyl-2-propan-2-ylpropanedioic acid (PubChem CID 88689806) has the molecular formula C14H29NO5
and a molecular weight of 291.39 g/mol. Its IUPAC name is 3-amino-2,3-dimethylbutan-2-ol;2-ethyl-2-propan-2-ylpropanedioic acid.
Molecular Properties
| Compound Name | 3-amino-2,3-dimethylbutan-2-ol;2-ethyl-2-propan-2-ylpropanedioic acid |
| PubChem CID | 88689806 |
| Molecular Formula | C14H29NO5 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | 3-amino-2,3-dimethylbutan-2-ol;2-ethyl-2-propan-2-ylpropanedioic acid |
| SMILES | CC(C)(N)C(C)(C)O.CCC(C(=O)O)(C(=O)O)C(C)C |
| InChI | InChI=1S/C8H14O4.C6H15NO/c1-4-8(5(2)3,6(9)10)7(11)12;1-5(2,7)6(3,4)8/h5H,4H2,1-3H3,(H,9,10)(H,11,12);8H,7H2,1-4H3 |
| InChIKey | NTIONZBVYRDGDL-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-2,3-dimethylbutan-2-ol;2-ethyl-2-propan-2-ylpropanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2,3-dimethylbutan-2-ol;2-ethyl-2-propan-2-ylpropanedioic acid?
The IUPAC name of 3-amino-2,3-dimethylbutan-2-ol;2-ethyl-2-propan-2-ylpropanedioic acid (CID 88689806) is 3-amino-2,3-dimethylbutan-2-ol;2-ethyl-2-propan-2-ylpropanedioic acid.
What is the SMILES notation for 3-amino-2,3-dimethylbutan-2-ol;2-ethyl-2-propan-2-ylpropanedioic acid?
The canonical SMILES for 3-amino-2,3-dimethylbutan-2-ol;2-ethyl-2-propan-2-ylpropanedioic acid is CC(C)(N)C(C)(C)O.CCC(C(=O)O)(C(=O)O)C(C)C.
What is the InChIKey of 3-amino-2,3-dimethylbutan-2-ol;2-ethyl-2-propan-2-ylpropanedioic acid?
The InChIKey is NTIONZBVYRDGDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O4.C6H15NO/c1-4-8(5(2)3,6(9)10)7(11)12;1-5(2,7)6(3,4)8/h5H,4H2,1-3H3,(H,9,10)(H,11,12);8H,7H2,1-4H3.
What are the key properties of 3-amino-2,3-dimethylbutan-2-ol;2-ethyl-2-propan-2-ylpropanedioic acid?
3-amino-2,3-dimethylbutan-2-ol;2-ethyl-2-propan-2-ylpropanedioic acid has a molecular weight of 291.39 g/mol, XLogP of 1.70, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2,3-dimethylbutan-2-ol;2-ethyl-2-propan-2-ylpropanedioic acid is sourced from PubChem (CID 88689806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).