C7H15NO6 — CID 175193728
1-aminopropane-1,1-diol;butanedioic acid (PubChem CID 175193728) has the molecular formula C7H15NO6 and a molecular weight of 209.20 g/mol. Its IUPAC name is 1-aminopropane-1,1-diol;butanedioic acid.
| Compound Name | 1-aminopropane-1,1-diol;butanedioic acid |
|---|---|
| PubChem CID | 175193728 |
| Molecular Formula | C7H15NO6 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | 1-aminopropane-1,1-diol;butanedioic acid |
| SMILES | CCC(N)(O)O.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C4H6O4.C3H9NO2/c5-3(6)1-2-4(7)8;1-2-3(4,5)6/h1-2H2,(H,5,6)(H,7,8);5-6H,2,4H2,1H3 |
| InChIKey | IHFKQUICJLWKCR-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|