C15H26O6 — CID 154825274
3-tert-butyl-2-ethyl-2-[(2-methylpropan-2-yl)oxycarbonyl]butanedioic acid (PubChem CID 154825274) has the molecular formula C15H26O6 and a molecular weight of 302.37 g/mol. Its IUPAC name is 3-tert-butyl-2-ethyl-2-[(2-methylpropan-2-yl)oxycarbonyl]butanedioic acid.
| Compound Name | 3-tert-butyl-2-ethyl-2-[(2-methylpropan-2-yl)oxycarbonyl]butanedioic acid |
|---|---|
| PubChem CID | 154825274 |
| Molecular Formula | C15H26O6 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 3-tert-butyl-2-ethyl-2-[(2-methylpropan-2-yl)oxycarbonyl]butanedioic acid |
| SMILES | CCC(C(=O)O)(C(=O)OC(C)(C)C)C(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C15H26O6/c1-8-15(11(18)19,12(20)21-14(5,6)7)9(10(16)17)13(2,3)4/h9H,8H2,1-7H3,(H,16,17)(H,18,19) |
| InChIKey | CJAXRIRDLWVMOK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|