C8H18LiNO2 — CID 174387889
lithium;2-amino-2,3,3-trimethylpentanoic acid;hydride (PubChem CID 174387889) has the molecular formula C8H18LiNO2 and a molecular weight of 167.18 g/mol. Its IUPAC name is lithium;2-amino-2,3,3-trimethylpentanoic acid;hydride.
| Compound Name | lithium;2-amino-2,3,3-trimethylpentanoic acid;hydride |
|---|---|
| PubChem CID | 174387889 |
| Molecular Formula | C8H18LiNO2 |
| Molecular Weight | 167.18 g/mol |
| Exact Mass | 167.15 |
| IUPAC Name | lithium;2-amino-2,3,3-trimethylpentanoic acid;hydride |
| SMILES | CCC(C)(C)C(C)(N)C(=O)O.[H-].[Li+] |
| InChI | InChI=1S/C8H17NO2.Li.H/c1-5-7(2,3)8(4,9)6(10)11;;/h5,9H2,1-4H3,(H,10,11);;/q;+1;-1 |
| InChIKey | MCEGTJNGUGIVNO-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.18 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |