C10H20O3S — CID 114491469
2-(2-ethyl-2-hydroxybutyl)sulfanyl-2-methylpropanoic acid (PubChem CID 114491469) has the molecular formula C10H20O3S and a molecular weight of 220.33 g/mol. Its IUPAC name is 2-(2-ethyl-2-hydroxybutyl)sulfanyl-2-methylpropanoic acid.
| Compound Name | 2-(2-ethyl-2-hydroxybutyl)sulfanyl-2-methylpropanoic acid |
|---|---|
| PubChem CID | 114491469 |
| Molecular Formula | C10H20O3S |
| Molecular Weight | 220.33 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 2-(2-ethyl-2-hydroxybutyl)sulfanyl-2-methylpropanoic acid |
| SMILES | CCC(O)(CC)CSC(C)(C)C(=O)O |
| InChI | InChI=1S/C10H20O3S/c1-5-10(13,6-2)7-14-9(3,4)8(11)12/h13H,5-7H2,1-4H3,(H,11,12) |
| InChIKey | VNTXBXNQIMIPJA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.33 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |