C8H17NO3S — CID 104930585
(2R)-2-amino-3-(2-hydroxy-2-methylbutyl)sulfanylpropanoic acid (PubChem CID 104930585) has the molecular formula C8H17NO3S and a molecular weight of 207.29 g/mol. Its IUPAC name is (2R)-2-amino-3-(2-hydroxy-2-methylbutyl)sulfanylpropanoic acid.
| Compound Name | (2R)-2-amino-3-(2-hydroxy-2-methylbutyl)sulfanylpropanoic acid |
|---|---|
| PubChem CID | 104930585 |
| Molecular Formula | C8H17NO3S |
| Molecular Weight | 207.29 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | (2R)-2-amino-3-(2-hydroxy-2-methylbutyl)sulfanylpropanoic acid |
| SMILES | CCC(C)(O)CSC[C@H](N)C(=O)O |
| InChI | InChI=1S/C8H17NO3S/c1-3-8(2,12)5-13-4-6(9)7(10)11/h6,12H,3-5,9H2,1-2H3,(H,10,11)/t6-,8?/m0/s1 |
| InChIKey | LMFJIMXGRCTEAZ-UUEFVBAFSA-N |
| XLogP | 0.29 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.29 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |