C23H46NO4+ — CID 140592483
[(Z,2R)-2-(carboxymethyl)-1,2-dihydroxyoctadec-11-enyl]-trimethylazanium (PubChem CID 140592483) has the molecular formula C23H46NO4+ and a molecular weight of 400.62 g/mol. Its IUPAC name is [(Z,2R)-2-(carboxymethyl)-1,2-dihydroxyoctadec-11-enyl]-trimethylazanium.
| Compound Name | [(Z,2R)-2-(carboxymethyl)-1,2-dihydroxyoctadec-11-enyl]-trimethylazanium |
|---|---|
| PubChem CID | 140592483 |
| Molecular Formula | C23H46NO4+ |
| Molecular Weight | 400.62 g/mol |
| Exact Mass | 400.34 |
| IUPAC Name | [(Z,2R)-2-(carboxymethyl)-1,2-dihydroxyoctadec-11-enyl]-trimethylazanium |
| SMILES | CCCCCC/C=C\CCCCCCCC[C@@](O)(CC(=O)O)C(O)[N+](C)(C)C |
| InChI | InChI=1S/C23H45NO4/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23(28,20-21(25)26)22(27)24(2,3)4/h10-11,22,27-28H,5-9,12-20H2,1-4H3/p+1/b11-10-/t22?,23-/m1/s1 |
| InChIKey | CWYCZDPDILQEBF-VEZXRPSUSA-O |
| XLogP | 4.86 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.62 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|