C25H49NO4 — CID 140592476
(Z,3R)-3-hydroxy-3-[hydroxy-(trimethylazaniumyl)methyl]henicos-12-enoate (PubChem CID 140592476) has the molecular formula C25H49NO4 and a molecular weight of 427.67 g/mol. Its IUPAC name is (Z,3R)-3-hydroxy-3-[hydroxy-(trimethylazaniumyl)methyl]henicos-12-enoate.
| Compound Name | (Z,3R)-3-hydroxy-3-[hydroxy-(trimethylazaniumyl)methyl]henicos-12-enoate |
|---|---|
| PubChem CID | 140592476 |
| Molecular Formula | C25H49NO4 |
| Molecular Weight | 427.67 g/mol |
| Exact Mass | 427.37 |
| IUPAC Name | (Z,3R)-3-hydroxy-3-[hydroxy-(trimethylazaniumyl)methyl]henicos-12-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC[C@@](O)(CC(=O)[O-])C(O)[N+](C)(C)C |
| InChI | InChI=1S/C25H49NO4/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-25(30,22-23(27)28)24(29)26(2,3)4/h12-13,24,29-30H,5-11,14-22H2,1-4H3/b13-12-/t24?,25-/m1/s1 |
| InChIKey | SXHGBLIDIHQQLQ-GDXBGBQBSA-N |
| XLogP | 4.31 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.67 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|