C25H49NO4 — CID 173464830
(3R)-3-hydroxy-3-octadec-9-enoxy-4-(trimethylazaniumyl)butanoate (PubChem CID 173464830) has the molecular formula C25H49NO4 and a molecular weight of 427.67 g/mol. Its IUPAC name is (3R)-3-hydroxy-3-octadec-9-enoxy-4-(trimethylazaniumyl)butanoate.
| Compound Name | (3R)-3-hydroxy-3-octadec-9-enoxy-4-(trimethylazaniumyl)butanoate |
|---|---|
| PubChem CID | 173464830 |
| Molecular Formula | C25H49NO4 |
| Molecular Weight | 427.67 g/mol |
| Exact Mass | 427.37 |
| IUPAC Name | (3R)-3-hydroxy-3-octadec-9-enoxy-4-(trimethylazaniumyl)butanoate |
| SMILES | CCCCCCCCC=CCCCCCCCCO[C@](O)(CC(=O)[O-])C[N+](C)(C)C |
| InChI | InChI=1S/C25H49NO4/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-30-25(29,22-24(27)28)23-26(2,3)4/h12-13,29H,5-11,14-23H2,1-4H3/t25-/m1/s1 |
| InChIKey | CFBCOZNYQVEWCJ-RUZDIDTESA-N |
| XLogP | 4.58 |
| TPSA | 69.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.67 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|