C21H39NO3 — CID 156963711
(4E,6E)-3-hydroxy-3-[(trimethylazaniumyl)methyl]heptadeca-4,6-dienoate (PubChem CID 156963711) has the molecular formula C21H39NO3 and a molecular weight of 353.55 g/mol. Its IUPAC name is (4E,6E)-3-hydroxy-3-[(trimethylazaniumyl)methyl]heptadeca-4,6-dienoate.
| Compound Name | (4E,6E)-3-hydroxy-3-[(trimethylazaniumyl)methyl]heptadeca-4,6-dienoate |
|---|---|
| PubChem CID | 156963711 |
| Molecular Formula | C21H39NO3 |
| Molecular Weight | 353.55 g/mol |
| Exact Mass | 353.29 |
| IUPAC Name | (4E,6E)-3-hydroxy-3-[(trimethylazaniumyl)methyl]heptadeca-4,6-dienoate |
| SMILES | CCCCCCCCCC/C=C/C=C/C(O)(CC(=O)[O-])C[N+](C)(C)C |
| InChI | InChI=1S/C21H39NO3/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-21(25,18-20(23)24)19-22(2,3)4/h14-17,25H,5-13,18-19H2,1-4H3/b15-14+,17-16+ |
| InChIKey | MDSXUXANDGCYGY-JLXBFWJWSA-N |
| XLogP | 3.21 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.55 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|