C87H161AlO7 — CID 175773927
bis((Z)-4-ethyl-4-[(Z)-octadec-9-enyl]-3-oxodocos-13-enoate);propan-2-yloxyaluminum(2+) (PubChem CID 175773927) has the molecular formula C87H161AlO7 and a molecular weight of 1346.22 g/mol. Its IUPAC name is bis((Z)-4-ethyl-4-[(Z)-octadec-9-enyl]-3-oxodocos-13-enoate);propan-2-yloxyaluminum(2+).
| Compound Name | bis((Z)-4-ethyl-4-[(Z)-octadec-9-enyl]-3-oxodocos-13-enoate);propan-2-yloxyaluminum(2+) |
|---|---|
| PubChem CID | 175773927 |
| Molecular Formula | C87H161AlO7 |
| Molecular Weight | 1346.22 g/mol |
| Exact Mass | 1345.21 |
| IUPAC Name | bis((Z)-4-ethyl-4-[(Z)-octadec-9-enyl]-3-oxodocos-13-enoate);propan-2-yloxyaluminum(2+) |
| SMILES | CC(C)O[Al+2].CCCCCCCC/C=C\CCCCCCCCC(CC)(CCCCCCCC/C=C\CCCCCCCC)C(=O)CC(=O)[O-].CCCCCCCC/C=C\CCCCCCCCC(CC)(CCCCCCCC/C=C\CCCCCCCC)C(=O)CC(=O)[O-] |
| InChI | InChI=1S/2C42H78O3.C3H7O.Al/c2*1-4-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-42(6-3,40(43)39-41(44)45)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-5-2;1-3(2)4;/h2*19-22H,4-18,23-39H2,1-3H3,(H,44,45);3H,1-2H3;/q;;-1;+3/p-2/b2*21-19-,22-20-;; |
| InChIKey | XTISTMTXLZOHHT-FIMSKHTFSA-L |
| XLogP | 26.39 |
| TPSA | 123.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 73 |
| Heavy Atoms | 95 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1346.22 |
| LogP ≤ 5 | 26.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|