About octadec-9-enoate;tris(propan-2-olate);titanium(4+)
octadec-9-enoate;tris(propan-2-olate);titanium(4+) (PubChem CID 173481476) has the molecular formula C27H54O5Ti
and a molecular weight of 506.59 g/mol. Its IUPAC name is octadec-9-enoate;tris(propan-2-olate);titanium(4+).
Molecular Properties
| Compound Name | octadec-9-enoate;tris(propan-2-olate);titanium(4+) |
| PubChem CID | 173481476 |
| Molecular Formula | C27H54O5Ti |
| Molecular Weight | 506.59 g/mol |
| Exact Mass | 506.35 |
| IUPAC Name | octadec-9-enoate;tris(propan-2-olate);titanium(4+) |
| SMILES | CC(C)[O-].CC(C)[O-].CC(C)[O-].CCCCCCCCC=CCCCCCCCC(=O)[O-].[Ti+4] |
| InChI | InChI=1S/C18H34O2.3C3H7O.Ti/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;3*1-3(2)4;/h9-10H,2-8,11-17H2,1H3,(H,19,20);3*3H,1-2H3;/q;3*-1;+4/p-1 |
| InChIKey | ZHORXVUHCIWPHC-UHFFFAOYSA-M |
| XLogP | 4.04 |
| TPSA | 109.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 506.59 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze octadec-9-enoate;tris(propan-2-olate);titanium(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octadec-9-enoate;tris(propan-2-olate);titanium(4+)?
The IUPAC name of octadec-9-enoate;tris(propan-2-olate);titanium(4+) (CID 173481476) is octadec-9-enoate;tris(propan-2-olate);titanium(4+).
What is the SMILES notation for octadec-9-enoate;tris(propan-2-olate);titanium(4+)?
The canonical SMILES for octadec-9-enoate;tris(propan-2-olate);titanium(4+) is CC(C)[O-].CC(C)[O-].CC(C)[O-].CCCCCCCCC=CCCCCCCCC(=O)[O-].[Ti+4].
What is the InChIKey of octadec-9-enoate;tris(propan-2-olate);titanium(4+)?
The InChIKey is ZHORXVUHCIWPHC-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H34O2.3C3H7O.Ti/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;3*1-3(2)4;/h9-10H,2-8,11-17H2,1H3,(H,19,20);3*3H,1-2H3;/q;3*-1;+4/p-1.
What are the key properties of octadec-9-enoate;tris(propan-2-olate);titanium(4+)?
octadec-9-enoate;tris(propan-2-olate);titanium(4+) has a molecular weight of 506.59 g/mol, XLogP of 4.04, 15 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for octadec-9-enoate;tris(propan-2-olate);titanium(4+) is sourced from PubChem (CID 173481476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).