C17H19BrN2O2 — CID 131717128
2-bromo-N-tert-butyl-N'-[cyclopenta-2,4-dien-1-ylidene(hydroxy)methyl]benzohydrazide (PubChem CID 131717128) has the molecular formula C17H19BrN2O2 and a molecular weight of 363.25 g/mol. Its IUPAC name is 2-bromo-N-tert-butyl-N'-[cyclopenta-2,4-dien-1-ylidene(hydroxy)methyl]benzohydrazide.
| Compound Name | 2-bromo-N-tert-butyl-N'-[cyclopenta-2,4-dien-1-ylidene(hydroxy)methyl]benzohydrazide |
|---|---|
| PubChem CID | 131717128 |
| Molecular Formula | C17H19BrN2O2 |
| Molecular Weight | 363.25 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | 2-bromo-N-tert-butyl-N'-[cyclopenta-2,4-dien-1-ylidene(hydroxy)methyl]benzohydrazide |
| SMILES | CC(C)(C)N(NC(O)=C1C=CC=C1)C(=O)c1ccccc1Br |
| InChI | InChI=1S/C17H19BrN2O2/c1-17(2,3)20(19-15(21)12-8-4-5-9-12)16(22)13-10-6-7-11-14(13)18/h4-11,19,21H,1-3H3 |
| InChIKey | BLFMCRQDOFHXGL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.25 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|