C14H17ClHgOS — CID 13171795
chloro-(2,2,5,5-tetramethyl-4-phenylsulfanylfuran-3-yl)mercury (PubChem CID 13171795) has the molecular formula C14H17ClHgOS and a molecular weight of 469.40 g/mol. Its IUPAC name is chloro-(2,2,5,5-tetramethyl-4-phenylsulfanylfuran-3-yl)mercury.
| Compound Name | chloro-(2,2,5,5-tetramethyl-4-phenylsulfanylfuran-3-yl)mercury |
|---|---|
| PubChem CID | 13171795 |
| Molecular Formula | C14H17ClHgOS |
| Molecular Weight | 469.40 g/mol |
| Exact Mass | 470.04 |
| IUPAC Name | chloro-(2,2,5,5-tetramethyl-4-phenylsulfanylfuran-3-yl)mercury |
| SMILES | CC1(C)OC(C)(C)C([Hg]Cl)=C1Sc1ccccc1 |
| InChI | InChI=1S/C14H17OS.ClH.Hg/c1-13(2)10-12(14(3,4)15-13)16-11-8-6-5-7-9-11;;/h5-9H,1-4H3;1H;/q;;+1/p-1 |
| InChIKey | ALHXPVGIGNFPCG-UHFFFAOYSA-M |
| XLogP | 4.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.40 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|