About cyclopenta-2,4-dien-1-yl-(1H-inden-1-yl)-phenylborane
cyclopenta-2,4-dien-1-yl-(1H-inden-1-yl)-phenylborane (PubChem CID 131721399) has the molecular formula C20H17B
and a molecular weight of 268.17 g/mol. Its IUPAC name is cyclopenta-2,4-dien-1-yl-(1H-inden-1-yl)-phenylborane.
Molecular Properties
| Compound Name | cyclopenta-2,4-dien-1-yl-(1H-inden-1-yl)-phenylborane |
| PubChem CID | 131721399 |
| Molecular Formula | C20H17B |
| Molecular Weight | 268.17 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | cyclopenta-2,4-dien-1-yl-(1H-inden-1-yl)-phenylborane |
| SMILES | C1=CC(B(c2ccccc2)C2C=Cc3ccccc32)C=C1 |
| InChI | InChI=1S/C20H17B/c1-2-9-17(10-3-1)21(18-11-5-6-12-18)20-15-14-16-8-4-7-13-19(16)20/h1-15,18,20H |
| InChIKey | KERSPVSPIIPQGP-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.17 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cyclopenta-2,4-dien-1-yl-(1H-inden-1-yl)-phenylborane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-2,4-dien-1-yl-(1H-inden-1-yl)-phenylborane?
The IUPAC name of cyclopenta-2,4-dien-1-yl-(1H-inden-1-yl)-phenylborane (CID 131721399) is cyclopenta-2,4-dien-1-yl-(1H-inden-1-yl)-phenylborane.
What is the SMILES notation for cyclopenta-2,4-dien-1-yl-(1H-inden-1-yl)-phenylborane?
The canonical SMILES for cyclopenta-2,4-dien-1-yl-(1H-inden-1-yl)-phenylborane is C1=CC(B(c2ccccc2)C2C=Cc3ccccc32)C=C1.
What is the InChIKey of cyclopenta-2,4-dien-1-yl-(1H-inden-1-yl)-phenylborane?
The InChIKey is KERSPVSPIIPQGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17B/c1-2-9-17(10-3-1)21(18-11-5-6-12-18)20-15-14-16-8-4-7-13-19(16)20/h1-15,18,20H.
What are the key properties of cyclopenta-2,4-dien-1-yl-(1H-inden-1-yl)-phenylborane?
cyclopenta-2,4-dien-1-yl-(1H-inden-1-yl)-phenylborane has a molecular weight of 268.17 g/mol, XLogP of 4.23, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-2,4-dien-1-yl-(1H-inden-1-yl)-phenylborane is sourced from PubChem (CID 131721399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).