About 5-(4-chlorophenyl)-4-propan-2-yl-1,2-oxazol-3-one;ethyl 2-(4-chlorobenzoyl)-3-methylbutanoate
5-(4-chlorophenyl)-4-propan-2-yl-1,2-oxazol-3-one;ethyl 2-(4-chlorobenzoyl)-3-methylbutanoate (PubChem CID 131721519) has the molecular formula C26H29Cl2NO5
and a molecular weight of 506.43 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-4-propan-2-yl-1,2-oxazol-3-one;ethyl 2-(4-chlorobenzoyl)-3-methylbutanoate.
Molecular Properties
| Compound Name | 5-(4-chlorophenyl)-4-propan-2-yl-1,2-oxazol-3-one;ethyl 2-(4-chlorobenzoyl)-3-methylbutanoate |
| PubChem CID | 131721519 |
| Molecular Formula | C26H29Cl2NO5 |
| Molecular Weight | 506.43 g/mol |
| Exact Mass | 505.14 |
| IUPAC Name | 5-(4-chlorophenyl)-4-propan-2-yl-1,2-oxazol-3-one;ethyl 2-(4-chlorobenzoyl)-3-methylbutanoate |
| SMILES | CC(C)c1c(-c2ccc(Cl)cc2)o[nH]c1=O.CCOC(=O)C(C(=O)c1ccc(Cl)cc1)C(C)C |
| InChI | InChI=1S/C14H17ClO3.C12H12ClNO2/c1-4-18-14(17)12(9(2)3)13(16)10-5-7-11(15)8-6-10;1-7(2)10-11(16-14-12(10)15)8-3-5-9(13)6-4-8/h5-9,12H,4H2,1-3H3;3-7H,1-2H3,(H,14,15) |
| InChIKey | SCOGRSVNFDGAJT-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 506.43 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-chlorophenyl)-4-propan-2-yl-1,2-oxazol-3-one;ethyl 2-(4-chlorobenzoyl)-3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-chlorophenyl)-4-propan-2-yl-1,2-oxazol-3-one;ethyl 2-(4-chlorobenzoyl)-3-methylbutanoate?
The IUPAC name of 5-(4-chlorophenyl)-4-propan-2-yl-1,2-oxazol-3-one;ethyl 2-(4-chlorobenzoyl)-3-methylbutanoate (CID 131721519) is 5-(4-chlorophenyl)-4-propan-2-yl-1,2-oxazol-3-one;ethyl 2-(4-chlorobenzoyl)-3-methylbutanoate.
What is the SMILES notation for 5-(4-chlorophenyl)-4-propan-2-yl-1,2-oxazol-3-one;ethyl 2-(4-chlorobenzoyl)-3-methylbutanoate?
The canonical SMILES for 5-(4-chlorophenyl)-4-propan-2-yl-1,2-oxazol-3-one;ethyl 2-(4-chlorobenzoyl)-3-methylbutanoate is CC(C)c1c(-c2ccc(Cl)cc2)o[nH]c1=O.CCOC(=O)C(C(=O)c1ccc(Cl)cc1)C(C)C.
What is the InChIKey of 5-(4-chlorophenyl)-4-propan-2-yl-1,2-oxazol-3-one;ethyl 2-(4-chlorobenzoyl)-3-methylbutanoate?
The InChIKey is SCOGRSVNFDGAJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17ClO3.C12H12ClNO2/c1-4-18-14(17)12(9(2)3)13(16)10-5-7-11(15)8-6-10;1-7(2)10-11(16-14-12(10)15)8-3-5-9(13)6-4-8/h5-9,12H,4H2,1-3H3;3-7H,1-2H3,(H,14,15).
What are the key properties of 5-(4-chlorophenyl)-4-propan-2-yl-1,2-oxazol-3-one;ethyl 2-(4-chlorobenzoyl)-3-methylbutanoate?
5-(4-chlorophenyl)-4-propan-2-yl-1,2-oxazol-3-one;ethyl 2-(4-chlorobenzoyl)-3-methylbutanoate has a molecular weight of 506.43 g/mol, XLogP of 6.77, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-chlorophenyl)-4-propan-2-yl-1,2-oxazol-3-one;ethyl 2-(4-chlorobenzoyl)-3-methylbutanoate is sourced from PubChem (CID 131721519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).