C15H13O3S- — CID 131721647
2-methoxy-5-(3-methyl-1-benzothiophen-2-yl)penta-2,4-dienoate (PubChem CID 131721647) has the molecular formula C15H13O3S- and a molecular weight of 273.33 g/mol. Its IUPAC name is 2-methoxy-5-(3-methyl-1-benzothiophen-2-yl)penta-2,4-dienoate.
| Compound Name | 2-methoxy-5-(3-methyl-1-benzothiophen-2-yl)penta-2,4-dienoate |
|---|---|
| PubChem CID | 131721647 |
| Molecular Formula | C15H13O3S- |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 2-methoxy-5-(3-methyl-1-benzothiophen-2-yl)penta-2,4-dienoate |
| SMILES | COC(=CC=Cc1sc2ccccc2c1C)C(=O)[O-] |
| InChI | InChI=1S/C15H14O3S/c1-10-11-6-3-4-8-14(11)19-13(10)9-5-7-12(18-2)15(16)17/h3-9H,1-2H3,(H,16,17)/p-1 |
| InChIKey | HCIDCHRKJAOJIT-UHFFFAOYSA-M |
| XLogP | 2.50 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|