C17H19NO2S — CID 92897085
[2-[(1Z)-4-methylpenta-1,3-dienyl]-1-benzothiophen-3-yl] N,N-dimethylcarbamate (PubChem CID 92897085) has the molecular formula C17H19NO2S and a molecular weight of 301.41 g/mol. Its IUPAC name is [2-[(1Z)-4-methylpenta-1,3-dienyl]-1-benzothiophen-3-yl] N,N-dimethylcarbamate.
| Compound Name | [2-[(1Z)-4-methylpenta-1,3-dienyl]-1-benzothiophen-3-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 92897085 |
| Molecular Formula | C17H19NO2S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | [2-[(1Z)-4-methylpenta-1,3-dienyl]-1-benzothiophen-3-yl] N,N-dimethylcarbamate |
| SMILES | CC(C)=C/C=C\c1sc2ccccc2c1OC(=O)N(C)C |
| InChI | InChI=1S/C17H19NO2S/c1-12(2)8-7-11-15-16(20-17(19)18(3)4)13-9-5-6-10-14(13)21-15/h5-11H,1-4H3/b11-7- |
| InChIKey | SQAJPIQVHDIOCO-XFFZJAGNSA-N |
| XLogP | 4.94 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|