C12H24N8O2 — CID 131722135
1-(1-methylpiperazin-2-yl)-3-[(1-methylpiperazin-2-yl)carbamoylimino]urea (PubChem CID 131722135) has the molecular formula C12H24N8O2 and a molecular weight of 312.38 g/mol. Its IUPAC name is 1-(1-methylpiperazin-2-yl)-3-[(1-methylpiperazin-2-yl)carbamoylimino]urea.
| Compound Name | 1-(1-methylpiperazin-2-yl)-3-[(1-methylpiperazin-2-yl)carbamoylimino]urea |
|---|---|
| PubChem CID | 131722135 |
| Molecular Formula | C12H24N8O2 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 1-(1-methylpiperazin-2-yl)-3-[(1-methylpiperazin-2-yl)carbamoylimino]urea |
| SMILES | CN1CCNCC1NC(=O)N=NC(=O)NC1CNCCN1C |
| InChI | InChI=1S/C12H24N8O2/c1-19-5-3-13-7-9(19)15-11(21)17-18-12(22)16-10-8-14-4-6-20(10)2/h9-10,13-14H,3-8H2,1-2H3,(H,15,21)(H,16,22) |
| InChIKey | JMCXRQZPNLYNCN-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 113.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|