C6H16N2O — CID 173257182
1,2-dimethylpiperazine;hydrate (PubChem CID 173257182) has the molecular formula C6H16N2O and a molecular weight of 132.21 g/mol. Its IUPAC name is 1,2-dimethylpiperazine;hydrate.
| Compound Name | 1,2-dimethylpiperazine;hydrate |
|---|---|
| PubChem CID | 173257182 |
| Molecular Formula | C6H16N2O |
| Molecular Weight | 132.21 g/mol |
| Exact Mass | 132.13 |
| IUPAC Name | 1,2-dimethylpiperazine;hydrate |
| SMILES | CC1CNCCN1C.O |
| InChI | InChI=1S/C6H14N2.H2O/c1-6-5-7-3-4-8(6)2;/h6-7H,3-5H2,1-2H3;1H2 |
| InChIKey | XBBKFKLOLJLLQH-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 46.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.21 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |