C11H19N3 — CID 174829234
1,2-dimethylpiperazine;pyridine (PubChem CID 174829234) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is 1,2-dimethylpiperazine;pyridine.
| Compound Name | 1,2-dimethylpiperazine;pyridine |
|---|---|
| PubChem CID | 174829234 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 1,2-dimethylpiperazine;pyridine |
| SMILES | CC1CNCCN1C.c1ccncc1 |
| InChI | InChI=1S/C6H14N2.C5H5N/c1-6-5-7-3-4-8(6)2;1-2-4-6-5-3-1/h6-7H,3-5H2,1-2H3;1-5H |
| InChIKey | FYIKRXZOPTZTMX-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |