C9H24N2O — CID 177244174
1,2-dimethylpiperazine;ethanol;methane (PubChem CID 177244174) has the molecular formula C9H24N2O and a molecular weight of 176.30 g/mol. Its IUPAC name is 1,2-dimethylpiperazine;ethanol;methane.
| Compound Name | 1,2-dimethylpiperazine;ethanol;methane |
|---|---|
| PubChem CID | 177244174 |
| Molecular Formula | C9H24N2O |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.19 |
| IUPAC Name | 1,2-dimethylpiperazine;ethanol;methane |
| SMILES | C.CC1CNCCN1C.CCO |
| InChI | InChI=1S/C6H14N2.C2H6O.CH4/c1-6-5-7-3-4-8(6)2;1-2-3;/h6-7H,3-5H2,1-2H3;3H,2H2,1H3;1H4 |
| InChIKey | LDUZNZDUFUFYRW-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |