C31H38N2O8 — CID 131722234
(1S,2R,3S)-1-(1,3-benzodioxol-5-yl)-3-[2-(1-hydroxyethoxy)-4-methoxyphenyl]-5-propoxy-2,3-dihydro-1H-indene-2-carboxylic acid;ethane-1,2-diamine (PubChem CID 131722234) has the molecular formula C31H38N2O8 and a molecular weight of 566.65 g/mol. Its IUPAC name is (1S,2R,3S)-1-(1,3-benzodioxol-5-yl)-3-[2-(1-hydroxyethoxy)-4-methoxyphenyl]-5-propoxy-2,3-dihydro-1H-indene-2-carboxylic acid;ethane-1,2-diamine.
| Compound Name | (1S,2R,3S)-1-(1,3-benzodioxol-5-yl)-3-[2-(1-hydroxyethoxy)-4-methoxyphenyl]-5-propoxy-2,3-dihydro-1H-indene-2-carboxylic acid;ethane-1,2-diamine |
|---|---|
| PubChem CID | 131722234 |
| Molecular Formula | C31H38N2O8 |
| Molecular Weight | 566.65 g/mol |
| Exact Mass | 566.26 |
| IUPAC Name | (1S,2R,3S)-1-(1,3-benzodioxol-5-yl)-3-[2-(1-hydroxyethoxy)-4-methoxyphenyl]-5-propoxy-2,3-dihydro-1H-indene-2-carboxylic acid;ethane-1,2-diamine |
| SMILES | CCCOc1ccc2c(c1)[C@@H](c1ccc(OC)cc1OC(C)O)[C@H](C(=O)O)[C@H]2c1ccc2c(c1)OCO2.NCCN |
| InChI | InChI=1S/C29H30O8.C2H8N2/c1-4-11-34-19-7-8-20-22(13-19)27(21-9-6-18(33-3)14-24(21)37-16(2)30)28(29(31)32)26(20)17-5-10-23-25(12-17)36-15-35-23;3-1-2-4/h5-10,12-14,16,26-28,30H,4,11,15H2,1-3H3,(H,31,32);1-4H2/t16?,26-,27+,28+;/m0./s1 |
| InChIKey | IBHXDXITYPALOB-AOBCLRMASA-N |
| XLogP | 3.81 |
| TPSA | 155.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.65 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|