C21H23F3N5O5- — CID 131722762
5-methyl-6-[(3,4,5-trimethoxyanilino)methyl]quinazoline-2,4-diamine;2,2,2-trifluoroacetate (PubChem CID 131722762) has the molecular formula C21H23F3N5O5- and a molecular weight of 482.44 g/mol. Its IUPAC name is 5-methyl-6-[(3,4,5-trimethoxyanilino)methyl]quinazoline-2,4-diamine;2,2,2-trifluoroacetate.
| Compound Name | 5-methyl-6-[(3,4,5-trimethoxyanilino)methyl]quinazoline-2,4-diamine;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 131722762 |
| Molecular Formula | C21H23F3N5O5- |
| Molecular Weight | 482.44 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | 5-methyl-6-[(3,4,5-trimethoxyanilino)methyl]quinazoline-2,4-diamine;2,2,2-trifluoroacetate |
| SMILES | COc1cc(NCc2ccc3nc(N)nc(N)c3c2C)cc(OC)c1OC.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C19H23N5O3.C2HF3O2/c1-10-11(5-6-13-16(10)18(20)24-19(21)23-13)9-22-12-7-14(25-2)17(27-4)15(8-12)26-3;3-2(4,5)1(6)7/h5-8,22H,9H2,1-4H3,(H4,20,21,23,24);(H,6,7)/p-1 |
| InChIKey | ZOTQUSKEXQSUSO-UHFFFAOYSA-M |
| XLogP | 2.04 |
| TPSA | 157.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.44 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|