C12H15N3S — CID 131724409
[(1R,2R)-2-azidocyclohexyl]sulfanylbenzene (PubChem CID 131724409) has the molecular formula C12H15N3S and a molecular weight of 233.34 g/mol. Its IUPAC name is [(1R,2R)-2-azidocyclohexyl]sulfanylbenzene.
| Compound Name | [(1R,2R)-2-azidocyclohexyl]sulfanylbenzene |
|---|---|
| PubChem CID | 131724409 |
| Molecular Formula | C12H15N3S |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | [(1R,2R)-2-azidocyclohexyl]sulfanylbenzene |
| SMILES | [N-]=[N+]=N[C@@H]1CCCC[C@H]1Sc1ccccc1 |
| InChI | InChI=1S/C12H15N3S/c13-15-14-11-8-4-5-9-12(11)16-10-6-2-1-3-7-10/h1-3,6-7,11-12H,4-5,8-9H2/t11-,12-/m1/s1 |
| InChIKey | MUFZLKAJBMBRKQ-VXGBXAGGSA-N |
| XLogP | 4.40 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|