C13H15NS2 — CID 12699792
(3aS,7aR)-2-phenylsulfanyl-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole (PubChem CID 12699792) has the molecular formula C13H15NS2 and a molecular weight of 249.40 g/mol. Its IUPAC name is (3aS,7aR)-2-phenylsulfanyl-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole.
| Compound Name | (3aS,7aR)-2-phenylsulfanyl-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole |
|---|---|
| PubChem CID | 12699792 |
| Molecular Formula | C13H15NS2 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | (3aS,7aR)-2-phenylsulfanyl-3a,4,5,6,7,7a-hexahydro-1,3-benzothiazole |
| SMILES | c1ccc(SC2=N[C@H]3CCCC[C@H]3S2)cc1 |
| InChI | InChI=1S/C13H15NS2/c1-2-6-10(7-3-1)15-13-14-11-8-4-5-9-12(11)16-13/h1-3,6-7,11-12H,4-5,8-9H2/t11-,12+/m0/s1 |
| InChIKey | ZXRMZYUECFADSG-NWDGAFQWSA-N |
| XLogP | 4.19 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |