C17H20Cl2N2O5 — CID 131725417
(2S)-4-[(3,4-dichlorophenyl)methoxyimino]-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (PubChem CID 131725417) has the molecular formula C17H20Cl2N2O5 and a molecular weight of 403.26 g/mol. Its IUPAC name is (2S)-4-[(3,4-dichlorophenyl)methoxyimino]-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-4-[(3,4-dichlorophenyl)methoxyimino]-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 131725417 |
| Molecular Formula | C17H20Cl2N2O5 |
| Molecular Weight | 403.26 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | (2S)-4-[(3,4-dichlorophenyl)methoxyimino]-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)N1CC(=NOCc2ccc(Cl)c(Cl)c2)C[C@H]1C(=O)O |
| InChI | InChI=1S/C17H20Cl2N2O5/c1-17(2,3)26-16(24)21-8-11(7-14(21)15(22)23)20-25-9-10-4-5-12(18)13(19)6-10/h4-6,14H,7-9H2,1-3H3,(H,22,23)/t14-/m0/s1 |
| InChIKey | SNSIPZVPHKFNNE-AWEZNQCLSA-N |
| XLogP | 3.96 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.26 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|