C26H32Cl2N4O4 — CID 152761687
(2S)-4-[(3,4-dichlorophenyl)methoxyimino]-2-N-(2-hydroxy-2-phenylethyl)-1-N-pentylpyrrolidine-1,2-dicarboxamide (PubChem CID 152761687) has the molecular formula C26H32Cl2N4O4 and a molecular weight of 535.47 g/mol. Its IUPAC name is (2S)-4-[(3,4-dichlorophenyl)methoxyimino]-2-N-(2-hydroxy-2-phenylethyl)-1-N-pentylpyrrolidine-1,2-dicarboxamide.
| Compound Name | (2S)-4-[(3,4-dichlorophenyl)methoxyimino]-2-N-(2-hydroxy-2-phenylethyl)-1-N-pentylpyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 152761687 |
| Molecular Formula | C26H32Cl2N4O4 |
| Molecular Weight | 535.47 g/mol |
| Exact Mass | 534.18 |
| IUPAC Name | (2S)-4-[(3,4-dichlorophenyl)methoxyimino]-2-N-(2-hydroxy-2-phenylethyl)-1-N-pentylpyrrolidine-1,2-dicarboxamide |
| SMILES | CCCCCNC(=O)N1CC(=NOCc2ccc(Cl)c(Cl)c2)C[C@H]1C(=O)NCC(O)c1ccccc1 |
| InChI | InChI=1S/C26H32Cl2N4O4/c1-2-3-7-12-29-26(35)32-16-20(31-36-17-18-10-11-21(27)22(28)13-18)14-23(32)25(34)30-15-24(33)19-8-5-4-6-9-19/h4-6,8-11,13,23-24,33H,2-3,7,12,14-17H2,1H3,(H,29,35)(H,30,34)/t23-,24?/m0/s1 |
| InChIKey | AROXMIYUMXHBDN-UXMRNZNESA-N |
| XLogP | 4.69 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.47 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|