C27H34N4O6 — CID 131725440
(2S)-2-N-(1,3-benzodioxol-5-ylmethyl)-4-[(4-methoxyphenyl)methoxyimino]-1-N-pentylpyrrolidine-1,2-dicarboxamide (PubChem CID 131725440) has the molecular formula C27H34N4O6 and a molecular weight of 510.59 g/mol. Its IUPAC name is (2S)-2-N-(1,3-benzodioxol-5-ylmethyl)-4-[(4-methoxyphenyl)methoxyimino]-1-N-pentylpyrrolidine-1,2-dicarboxamide.
| Compound Name | (2S)-2-N-(1,3-benzodioxol-5-ylmethyl)-4-[(4-methoxyphenyl)methoxyimino]-1-N-pentylpyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 131725440 |
| Molecular Formula | C27H34N4O6 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | (2S)-2-N-(1,3-benzodioxol-5-ylmethyl)-4-[(4-methoxyphenyl)methoxyimino]-1-N-pentylpyrrolidine-1,2-dicarboxamide |
| SMILES | CCCCCNC(=O)N1CC(=NOCc2ccc(OC)cc2)C[C@H]1C(=O)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C27H34N4O6/c1-3-4-5-12-28-27(33)31-16-21(30-37-17-19-6-9-22(34-2)10-7-19)14-23(31)26(32)29-15-20-8-11-24-25(13-20)36-18-35-24/h6-11,13,23H,3-5,12,14-18H2,1-2H3,(H,28,33)(H,29,32)/t23-/m0/s1 |
| InChIKey | YMTJJYIIMBRJND-QHCPKHFHSA-N |
| XLogP | 3.59 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|