C28H26F3N3O4 — CID 131725670
(2S)-N-[(2S)-2-hydroxy-2-phenylethyl]-4-methoxyimino-1-[2-[2-(trifluoromethyl)phenyl]benzoyl]pyrrolidine-2-carboxamide (PubChem CID 131725670) has the molecular formula C28H26F3N3O4 and a molecular weight of 525.53 g/mol. Its IUPAC name is (2S)-N-[(2S)-2-hydroxy-2-phenylethyl]-4-methoxyimino-1-[2-[2-(trifluoromethyl)phenyl]benzoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(2S)-2-hydroxy-2-phenylethyl]-4-methoxyimino-1-[2-[2-(trifluoromethyl)phenyl]benzoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 131725670 |
| Molecular Formula | C28H26F3N3O4 |
| Molecular Weight | 525.53 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | (2S)-N-[(2S)-2-hydroxy-2-phenylethyl]-4-methoxyimino-1-[2-[2-(trifluoromethyl)phenyl]benzoyl]pyrrolidine-2-carboxamide |
| SMILES | CON=C1C[C@@H](C(=O)NC[C@@H](O)c2ccccc2)N(C(=O)c2ccccc2-c2ccccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C28H26F3N3O4/c1-38-33-19-15-24(26(36)32-16-25(35)18-9-3-2-4-10-18)34(17-19)27(37)22-13-6-5-11-20(22)21-12-7-8-14-23(21)28(29,30)31/h2-14,24-25,35H,15-17H2,1H3,(H,32,36)/t24-,25+/m0/s1 |
| InChIKey | NYEJGAXASYIWJX-LOSJGSFVSA-N |
| XLogP | 4.44 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.53 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|