C28H29N3O6 — CID 10164145
(2S,4Z)-N-[2-hydroxy-2-(4-hydroxyphenyl)ethyl]-4-methoxyimino-1-[4-(2-methoxyphenyl)benzoyl]pyrrolidine-2-carboxamide (PubChem CID 10164145) has the molecular formula C28H29N3O6 and a molecular weight of 503.56 g/mol. Its IUPAC name is (2S,4Z)-N-[2-hydroxy-2-(4-hydroxyphenyl)ethyl]-4-methoxyimino-1-[4-(2-methoxyphenyl)benzoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4Z)-N-[2-hydroxy-2-(4-hydroxyphenyl)ethyl]-4-methoxyimino-1-[4-(2-methoxyphenyl)benzoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 10164145 |
| Molecular Formula | C28H29N3O6 |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | (2S,4Z)-N-[2-hydroxy-2-(4-hydroxyphenyl)ethyl]-4-methoxyimino-1-[4-(2-methoxyphenyl)benzoyl]pyrrolidine-2-carboxamide |
| SMILES | CO/N=C1/C[C@@H](C(=O)NCC(O)c2ccc(O)cc2)N(C(=O)c2ccc(-c3ccccc3OC)cc2)C1 |
| InChI | InChI=1S/C28H29N3O6/c1-36-26-6-4-3-5-23(26)18-7-9-20(10-8-18)28(35)31-17-21(30-37-2)15-24(31)27(34)29-16-25(33)19-11-13-22(32)14-12-19/h3-14,24-25,32-33H,15-17H2,1-2H3,(H,29,34)/b30-21-/t24-,25?/m0/s1 |
| InChIKey | PILBJJQELKVQHB-QATUFVOJSA-N |
| XLogP | 3.13 |
| TPSA | 120.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|