C29H28N4O4 — CID 178063729
1-[4-(3-cyano-2-methylphenyl)benzoyl]-N-(2-hydroxy-2-phenylethyl)-4-methoxyiminopyrrolidine-2-carboxamide (PubChem CID 178063729) has the molecular formula C29H28N4O4 and a molecular weight of 496.57 g/mol. Its IUPAC name is 1-[4-(3-cyano-2-methylphenyl)benzoyl]-N-(2-hydroxy-2-phenylethyl)-4-methoxyiminopyrrolidine-2-carboxamide.
| Compound Name | 1-[4-(3-cyano-2-methylphenyl)benzoyl]-N-(2-hydroxy-2-phenylethyl)-4-methoxyiminopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 178063729 |
| Molecular Formula | C29H28N4O4 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | 1-[4-(3-cyano-2-methylphenyl)benzoyl]-N-(2-hydroxy-2-phenylethyl)-4-methoxyiminopyrrolidine-2-carboxamide |
| SMILES | CON=C1CC(C(=O)NCC(O)c2ccccc2)N(C(=O)c2ccc(-c3cccc(C#N)c3C)cc2)C1 |
| InChI | InChI=1S/C29H28N4O4/c1-19-23(16-30)9-6-10-25(19)20-11-13-22(14-12-20)29(36)33-18-24(32-37-2)15-26(33)28(35)31-17-27(34)21-7-4-3-5-8-21/h3-14,26-27,34H,15,17-18H2,1-2H3,(H,31,35) |
| InChIKey | BXJNMTGGSIZXSA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 115.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|