C26H25N5O6 — CID 10141901
(4E)-N-[2-hydroxy-2-(4-nitrophenyl)ethyl]-4-methoxyimino-1-(4-pyridin-3-ylbenzoyl)pyrrolidine-2-carboxamide (PubChem CID 10141901) has the molecular formula C26H25N5O6 and a molecular weight of 503.52 g/mol. Its IUPAC name is (4E)-N-[2-hydroxy-2-(4-nitrophenyl)ethyl]-4-methoxyimino-1-(4-pyridin-3-ylbenzoyl)pyrrolidine-2-carboxamide.
| Compound Name | (4E)-N-[2-hydroxy-2-(4-nitrophenyl)ethyl]-4-methoxyimino-1-(4-pyridin-3-ylbenzoyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 10141901 |
| Molecular Formula | C26H25N5O6 |
| Molecular Weight | 503.52 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | (4E)-N-[2-hydroxy-2-(4-nitrophenyl)ethyl]-4-methoxyimino-1-(4-pyridin-3-ylbenzoyl)pyrrolidine-2-carboxamide |
| SMILES | CO/N=C1\CC(C(=O)NCC(O)c2ccc([N+](=O)[O-])cc2)N(C(=O)c2ccc(-c3cccnc3)cc2)C1 |
| InChI | InChI=1S/C26H25N5O6/c1-37-29-21-13-23(25(33)28-15-24(32)18-8-10-22(11-9-18)31(35)36)30(16-21)26(34)19-6-4-17(5-7-19)20-3-2-12-27-14-20/h2-12,14,23-24,32H,13,15-16H2,1H3,(H,28,33)/b29-21+ |
| InChIKey | RZCZWWTYJSRSMO-XHLNEMQHSA-N |
| XLogP | 2.72 |
| TPSA | 147.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.52 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|