C26H27N5O3 — CID 87752210
(2S,4E)-N-(2-anilinoethyl)-4-methoxyimino-1-(4-pyridin-4-ylbenzoyl)pyrrolidine-2-carboxamide (PubChem CID 87752210) has the molecular formula C26H27N5O3 and a molecular weight of 457.53 g/mol. Its IUPAC name is (2S,4E)-N-(2-anilinoethyl)-4-methoxyimino-1-(4-pyridin-4-ylbenzoyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S,4E)-N-(2-anilinoethyl)-4-methoxyimino-1-(4-pyridin-4-ylbenzoyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 87752210 |
| Molecular Formula | C26H27N5O3 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | (2S,4E)-N-(2-anilinoethyl)-4-methoxyimino-1-(4-pyridin-4-ylbenzoyl)pyrrolidine-2-carboxamide |
| SMILES | CO/N=C1\C[C@@H](C(=O)NCCNc2ccccc2)N(C(=O)c2ccc(-c3ccncc3)cc2)C1 |
| InChI | InChI=1S/C26H27N5O3/c1-34-30-23-17-24(25(32)29-16-15-28-22-5-3-2-4-6-22)31(18-23)26(33)21-9-7-19(8-10-21)20-11-13-27-14-12-20/h2-14,24,28H,15-18H2,1H3,(H,29,32)/b30-23+/t24-/m0/s1 |
| InChIKey | KKECGIOIEZVARE-SWWPGYFCSA-N |
| XLogP | 3.19 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|