C21H22N2O4 — CID 140538983
methyl 2-[(2S,4Z)-4-methoxyimino-1-(4-phenylbenzoyl)pyrrolidin-2-yl]acetate (PubChem CID 140538983) has the molecular formula C21H22N2O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is methyl 2-[(2S,4Z)-4-methoxyimino-1-(4-phenylbenzoyl)pyrrolidin-2-yl]acetate.
| Compound Name | methyl 2-[(2S,4Z)-4-methoxyimino-1-(4-phenylbenzoyl)pyrrolidin-2-yl]acetate |
|---|---|
| PubChem CID | 140538983 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | methyl 2-[(2S,4Z)-4-methoxyimino-1-(4-phenylbenzoyl)pyrrolidin-2-yl]acetate |
| SMILES | CO/N=C1/C[C@@H](CC(=O)OC)N(C(=O)c2ccc(-c3ccccc3)cc2)C1 |
| InChI | InChI=1S/C21H22N2O4/c1-26-20(24)13-19-12-18(22-27-2)14-23(19)21(25)17-10-8-16(9-11-17)15-6-4-3-5-7-15/h3-11,19H,12-14H2,1-2H3/b22-18-/t19-/m0/s1 |
| InChIKey | AVOGRRMMJVGQFI-ODXGNSPJSA-N |
| XLogP | 3.13 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|