C25H29N3O4 — CID 87236383
3-[(4Z)-4-methoxyimino-1-(4-phenylbenzoyl)pyrrolidin-2-yl]-1-morpholin-4-ylpropan-1-one (PubChem CID 87236383) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is 3-[(4Z)-4-methoxyimino-1-(4-phenylbenzoyl)pyrrolidin-2-yl]-1-morpholin-4-ylpropan-1-one.
| Compound Name | 3-[(4Z)-4-methoxyimino-1-(4-phenylbenzoyl)pyrrolidin-2-yl]-1-morpholin-4-ylpropan-1-one |
|---|---|
| PubChem CID | 87236383 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | 3-[(4Z)-4-methoxyimino-1-(4-phenylbenzoyl)pyrrolidin-2-yl]-1-morpholin-4-ylpropan-1-one |
| SMILES | CO/N=C1/CC(CCC(=O)N2CCOCC2)N(C(=O)c2ccc(-c3ccccc3)cc2)C1 |
| InChI | InChI=1S/C25H29N3O4/c1-31-26-22-17-23(11-12-24(29)27-13-15-32-16-14-27)28(18-22)25(30)21-9-7-20(8-10-21)19-5-3-2-4-6-19/h2-10,23H,11-18H2,1H3/b26-22- |
| InChIKey | PMALGQHRYVRUFC-ROMGYVFFSA-N |
| XLogP | 3.21 |
| TPSA | 71.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|