C22H20N4O3 — CID 10293622
[(2S,4E)-2-(5-ethenyl-1,2,4-oxadiazol-3-yl)-4-methoxyiminopyrrolidin-1-yl]-(4-phenylphenyl)methanone (PubChem CID 10293622) has the molecular formula C22H20N4O3 and a molecular weight of 388.43 g/mol. Its IUPAC name is [(2S,4E)-2-(5-ethenyl-1,2,4-oxadiazol-3-yl)-4-methoxyiminopyrrolidin-1-yl]-(4-phenylphenyl)methanone.
| Compound Name | [(2S,4E)-2-(5-ethenyl-1,2,4-oxadiazol-3-yl)-4-methoxyiminopyrrolidin-1-yl]-(4-phenylphenyl)methanone |
|---|---|
| PubChem CID | 10293622 |
| Molecular Formula | C22H20N4O3 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | [(2S,4E)-2-(5-ethenyl-1,2,4-oxadiazol-3-yl)-4-methoxyiminopyrrolidin-1-yl]-(4-phenylphenyl)methanone |
| SMILES | C=Cc1nc([C@@H]2C/C(=N\OC)CN2C(=O)c2ccc(-c3ccccc3)cc2)no1 |
| InChI | InChI=1S/C22H20N4O3/c1-3-20-23-21(25-29-20)19-13-18(24-28-2)14-26(19)22(27)17-11-9-16(10-12-17)15-7-5-4-6-8-15/h3-12,19H,1,13-14H2,2H3/b24-18+/t19-/m0/s1 |
| InChIKey | KAPANPVRXIUYKF-YJZSVRAESA-N |
| XLogP | 3.97 |
| TPSA | 80.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|