C25H22N4O3S — CID 10139320
[(2S,4E)-4-methoxyimino-2-[3-(thiophen-2-ylmethyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-(4-phenylphenyl)methanone (PubChem CID 10139320) has the molecular formula C25H22N4O3S and a molecular weight of 458.54 g/mol. Its IUPAC name is [(2S,4E)-4-methoxyimino-2-[3-(thiophen-2-ylmethyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-(4-phenylphenyl)methanone.
| Compound Name | [(2S,4E)-4-methoxyimino-2-[3-(thiophen-2-ylmethyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-(4-phenylphenyl)methanone |
|---|---|
| PubChem CID | 10139320 |
| Molecular Formula | C25H22N4O3S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | [(2S,4E)-4-methoxyimino-2-[3-(thiophen-2-ylmethyl)-1,2,4-oxadiazol-5-yl]pyrrolidin-1-yl]-(4-phenylphenyl)methanone |
| SMILES | CO/N=C1\C[C@@H](c2nc(Cc3cccs3)no2)N(C(=O)c2ccc(-c3ccccc3)cc2)C1 |
| InChI | InChI=1S/C25H22N4O3S/c1-31-27-20-14-22(24-26-23(28-32-24)15-21-8-5-13-33-21)29(16-20)25(30)19-11-9-18(10-12-19)17-6-3-2-4-7-17/h2-13,22H,14-16H2,1H3/b27-20+/t22-/m0/s1 |
| InChIKey | ISBUAAIVQSTNNV-LMTFXULLSA-N |
| XLogP | 4.98 |
| TPSA | 80.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|