C25H28N6O4 — CID 58714590
2-(dimethylamino)-N-[[3-[(2S)-4-methoxyimino-1-(4-phenylbenzoyl)pyrrolidin-2-yl]-1,2,4-oxadiazol-5-yl]methyl]acetamide (PubChem CID 58714590) has the molecular formula C25H28N6O4 and a molecular weight of 476.54 g/mol. Its IUPAC name is 2-(dimethylamino)-N-[[3-[(2S)-4-methoxyimino-1-(4-phenylbenzoyl)pyrrolidin-2-yl]-1,2,4-oxadiazol-5-yl]methyl]acetamide.
| Compound Name | 2-(dimethylamino)-N-[[3-[(2S)-4-methoxyimino-1-(4-phenylbenzoyl)pyrrolidin-2-yl]-1,2,4-oxadiazol-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 58714590 |
| Molecular Formula | C25H28N6O4 |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | 2-(dimethylamino)-N-[[3-[(2S)-4-methoxyimino-1-(4-phenylbenzoyl)pyrrolidin-2-yl]-1,2,4-oxadiazol-5-yl]methyl]acetamide |
| SMILES | CON=C1C[C@@H](c2noc(CNC(=O)CN(C)C)n2)N(C(=O)c2ccc(-c3ccccc3)cc2)C1 |
| InChI | InChI=1S/C25H28N6O4/c1-30(2)16-22(32)26-14-23-27-24(29-35-23)21-13-20(28-34-3)15-31(21)25(33)19-11-9-18(10-12-19)17-7-5-4-6-8-17/h4-12,21H,13-16H2,1-3H3,(H,26,32)/t21-/m0/s1 |
| InChIKey | LJUJDUVRFJVDIA-NRFANRHFSA-N |
| XLogP | 2.50 |
| TPSA | 113.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|