C27H28N4O5 — CID 87752356
(2S,4E)-N-[(2S)-2-hydroxy-3-phenoxypropyl]-4-methoxyimino-1-(4-pyridin-3-ylbenzoyl)pyrrolidine-2-carboxamide (PubChem CID 87752356) has the molecular formula C27H28N4O5 and a molecular weight of 488.54 g/mol. Its IUPAC name is (2S,4E)-N-[(2S)-2-hydroxy-3-phenoxypropyl]-4-methoxyimino-1-(4-pyridin-3-ylbenzoyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S,4E)-N-[(2S)-2-hydroxy-3-phenoxypropyl]-4-methoxyimino-1-(4-pyridin-3-ylbenzoyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 87752356 |
| Molecular Formula | C27H28N4O5 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | (2S,4E)-N-[(2S)-2-hydroxy-3-phenoxypropyl]-4-methoxyimino-1-(4-pyridin-3-ylbenzoyl)pyrrolidine-2-carboxamide |
| SMILES | CO/N=C1\C[C@@H](C(=O)NC[C@H](O)COc2ccccc2)N(C(=O)c2ccc(-c3cccnc3)cc2)C1 |
| InChI | InChI=1S/C27H28N4O5/c1-35-30-22-14-25(26(33)29-16-23(32)18-36-24-7-3-2-4-8-24)31(17-22)27(34)20-11-9-19(10-12-20)21-6-5-13-28-15-21/h2-13,15,23,25,32H,14,16-18H2,1H3,(H,29,33)/b30-22+/t23-,25-/m0/s1 |
| InChIKey | UZUNONJKVBMCDO-XWCBQLHASA-N |
| XLogP | 2.52 |
| TPSA | 113.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|