C28H30N4O6 — CID 10142659
(2S,4Z)-N-[2-hydroxy-3-(4-methoxyphenoxy)propyl]-4-methoxyimino-1-(4-pyridin-3-ylbenzoyl)pyrrolidine-2-carboxamide (PubChem CID 10142659) has the molecular formula C28H30N4O6 and a molecular weight of 518.57 g/mol. Its IUPAC name is (2S,4Z)-N-[2-hydroxy-3-(4-methoxyphenoxy)propyl]-4-methoxyimino-1-(4-pyridin-3-ylbenzoyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S,4Z)-N-[2-hydroxy-3-(4-methoxyphenoxy)propyl]-4-methoxyimino-1-(4-pyridin-3-ylbenzoyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 10142659 |
| Molecular Formula | C28H30N4O6 |
| Molecular Weight | 518.57 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | (2S,4Z)-N-[2-hydroxy-3-(4-methoxyphenoxy)propyl]-4-methoxyimino-1-(4-pyridin-3-ylbenzoyl)pyrrolidine-2-carboxamide |
| SMILES | CO/N=C1/C[C@@H](C(=O)NCC(O)COc2ccc(OC)cc2)N(C(=O)c2ccc(-c3cccnc3)cc2)C1 |
| InChI | InChI=1S/C28H30N4O6/c1-36-24-9-11-25(12-10-24)38-18-23(33)16-30-27(34)26-14-22(31-37-2)17-32(26)28(35)20-7-5-19(6-8-20)21-4-3-13-29-15-21/h3-13,15,23,26,33H,14,16-18H2,1-2H3,(H,30,34)/b31-22-/t23?,26-/m0/s1 |
| InChIKey | IJWQJDQXKIQXIH-KCWRRWBXSA-N |
| XLogP | 2.53 |
| TPSA | 122.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.57 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|