C20H21N3O4 — CID 22223601
(4E)-4-methoxyimino-1-[4-(2-methoxyphenyl)benzoyl]pyrrolidine-2-carboxamide (PubChem CID 22223601) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is (4E)-4-methoxyimino-1-[4-(2-methoxyphenyl)benzoyl]pyrrolidine-2-carboxamide.
| Compound Name | (4E)-4-methoxyimino-1-[4-(2-methoxyphenyl)benzoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 22223601 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | (4E)-4-methoxyimino-1-[4-(2-methoxyphenyl)benzoyl]pyrrolidine-2-carboxamide |
| SMILES | CO/N=C1\CC(C(N)=O)N(C(=O)c2ccc(-c3ccccc3OC)cc2)C1 |
| InChI | InChI=1S/C20H21N3O4/c1-26-18-6-4-3-5-16(18)13-7-9-14(10-8-13)20(25)23-12-15(22-27-2)11-17(23)19(21)24/h3-10,17H,11-12H2,1-2H3,(H2,21,24)/b22-15+ |
| InChIKey | HFEVBHWSDZPBBU-PXLXIMEGSA-N |
| XLogP | 2.06 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|