C27H27N3O3 — CID 131725459
(2S)-N-benzyl-1-(2,2-diphenylacetyl)-4-methoxyiminopyrrolidine-2-carboxamide (PubChem CID 131725459) has the molecular formula C27H27N3O3 and a molecular weight of 441.53 g/mol. Its IUPAC name is (2S)-N-benzyl-1-(2,2-diphenylacetyl)-4-methoxyiminopyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-benzyl-1-(2,2-diphenylacetyl)-4-methoxyiminopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 131725459 |
| Molecular Formula | C27H27N3O3 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | (2S)-N-benzyl-1-(2,2-diphenylacetyl)-4-methoxyiminopyrrolidine-2-carboxamide |
| SMILES | CON=C1C[C@@H](C(=O)NCc2ccccc2)N(C(=O)C(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C27H27N3O3/c1-33-29-23-17-24(26(31)28-18-20-11-5-2-6-12-20)30(19-23)27(32)25(21-13-7-3-8-14-21)22-15-9-4-10-16-22/h2-16,24-25H,17-19H2,1H3,(H,28,31)/t24-/m0/s1 |
| InChIKey | NIXWYJQVHUCOIO-DEOSSOPVSA-N |
| XLogP | 3.74 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|