C26H34N4O3 — CID 131726363
(2S)-N-[2-(diethylamino)ethyl]-1-(2,2-diphenylacetyl)-4-methoxyiminopyrrolidine-2-carboxamide (PubChem CID 131726363) has the molecular formula C26H34N4O3 and a molecular weight of 450.58 g/mol. Its IUPAC name is (2S)-N-[2-(diethylamino)ethyl]-1-(2,2-diphenylacetyl)-4-methoxyiminopyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[2-(diethylamino)ethyl]-1-(2,2-diphenylacetyl)-4-methoxyiminopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 131726363 |
| Molecular Formula | C26H34N4O3 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | (2S)-N-[2-(diethylamino)ethyl]-1-(2,2-diphenylacetyl)-4-methoxyiminopyrrolidine-2-carboxamide |
| SMILES | CCN(CC)CCNC(=O)[C@@H]1CC(=NOC)CN1C(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H34N4O3/c1-4-29(5-2)17-16-27-25(31)23-18-22(28-33-3)19-30(23)26(32)24(20-12-8-6-9-13-20)21-14-10-7-11-15-21/h6-15,23-24H,4-5,16-19H2,1-3H3,(H,27,31)/t23-/m0/s1 |
| InChIKey | FTZAJESCTKEMEN-QHCPKHFHSA-N |
| XLogP | 2.88 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|