C14H26N4O4 — CID 85054827
2-N-(2-hydroxyethyl)-4-methoxyimino-1-N-pentylpyrrolidine-1,2-dicarboxamide (PubChem CID 85054827) has the molecular formula C14H26N4O4 and a molecular weight of 314.39 g/mol. Its IUPAC name is 2-N-(2-hydroxyethyl)-4-methoxyimino-1-N-pentylpyrrolidine-1,2-dicarboxamide.
| Compound Name | 2-N-(2-hydroxyethyl)-4-methoxyimino-1-N-pentylpyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 85054827 |
| Molecular Formula | C14H26N4O4 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 2-N-(2-hydroxyethyl)-4-methoxyimino-1-N-pentylpyrrolidine-1,2-dicarboxamide |
| SMILES | CCCCCNC(=O)N1CC(=NOC)CC1C(=O)NCCO |
| InChI | InChI=1S/C14H26N4O4/c1-3-4-5-6-16-14(21)18-10-11(17-22-2)9-12(18)13(20)15-7-8-19/h12,19H,3-10H2,1-2H3,(H,15,20)(H,16,21) |
| InChIKey | IBWOAIHUHHQWTO-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|