C25H25N3O4 — CID 10224687
(4Z)-4-methoxyimino-N-(naphthalen-1-ylmethyl)-1-(2-phenoxyacetyl)pyrrolidine-2-carboxamide (PubChem CID 10224687) has the molecular formula C25H25N3O4 and a molecular weight of 431.49 g/mol. Its IUPAC name is (4Z)-4-methoxyimino-N-(naphthalen-1-ylmethyl)-1-(2-phenoxyacetyl)pyrrolidine-2-carboxamide.
| Compound Name | (4Z)-4-methoxyimino-N-(naphthalen-1-ylmethyl)-1-(2-phenoxyacetyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 10224687 |
| Molecular Formula | C25H25N3O4 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | (4Z)-4-methoxyimino-N-(naphthalen-1-ylmethyl)-1-(2-phenoxyacetyl)pyrrolidine-2-carboxamide |
| SMILES | CO/N=C1/CC(C(=O)NCc2cccc3ccccc23)N(C(=O)COc2ccccc2)C1 |
| InChI | InChI=1S/C25H25N3O4/c1-31-27-20-14-23(28(16-20)24(29)17-32-21-11-3-2-4-12-21)25(30)26-15-19-10-7-9-18-8-5-6-13-22(18)19/h2-13,23H,14-17H2,1H3,(H,26,30)/b27-20- |
| InChIKey | RZAUTCKGFSGBFU-OOAXWGSJSA-N |
| XLogP | 3.14 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|