C31H29N3O4 — CID 87752402
(2S,4E)-N-(naphthalen-1-ylmethyl)-1-(2-phenoxyacetyl)-4-phenylmethoxyiminopyrrolidine-2-carboxamide (PubChem CID 87752402) has the molecular formula C31H29N3O4 and a molecular weight of 507.59 g/mol. Its IUPAC name is (2S,4E)-N-(naphthalen-1-ylmethyl)-1-(2-phenoxyacetyl)-4-phenylmethoxyiminopyrrolidine-2-carboxamide.
| Compound Name | (2S,4E)-N-(naphthalen-1-ylmethyl)-1-(2-phenoxyacetyl)-4-phenylmethoxyiminopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 87752402 |
| Molecular Formula | C31H29N3O4 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | (2S,4E)-N-(naphthalen-1-ylmethyl)-1-(2-phenoxyacetyl)-4-phenylmethoxyiminopyrrolidine-2-carboxamide |
| SMILES | O=C(NCc1cccc2ccccc12)[C@@H]1C/C(=N\OCc2ccccc2)CN1C(=O)COc1ccccc1 |
| InChI | InChI=1S/C31H29N3O4/c35-30(22-37-27-15-5-2-6-16-27)34-20-26(33-38-21-23-10-3-1-4-11-23)18-29(34)31(36)32-19-25-14-9-13-24-12-7-8-17-28(24)25/h1-17,29H,18-22H2,(H,32,36)/b33-26+/t29-/m0/s1 |
| InChIKey | IBMUSXSBECWIRX-APIBJDRMSA-N |
| XLogP | 4.71 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|