C30H35N3O3 — CID 10277828
N-(5-aminopentyl)-2-[2-(4-phenylmethoxyphenyl)acetyl]-3,4-dihydro-1H-isoquinoline-3-carboxamide (PubChem CID 10277828) has the molecular formula C30H35N3O3 and a molecular weight of 485.63 g/mol. Its IUPAC name is N-(5-aminopentyl)-2-[2-(4-phenylmethoxyphenyl)acetyl]-3,4-dihydro-1H-isoquinoline-3-carboxamide.
| Compound Name | N-(5-aminopentyl)-2-[2-(4-phenylmethoxyphenyl)acetyl]-3,4-dihydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 10277828 |
| Molecular Formula | C30H35N3O3 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.27 |
| IUPAC Name | N-(5-aminopentyl)-2-[2-(4-phenylmethoxyphenyl)acetyl]-3,4-dihydro-1H-isoquinoline-3-carboxamide |
| SMILES | NCCCCCNC(=O)C1Cc2ccccc2CN1C(=O)Cc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C30H35N3O3/c31-17-7-2-8-18-32-30(35)28-20-25-11-5-6-12-26(25)21-33(28)29(34)19-23-13-15-27(16-14-23)36-22-24-9-3-1-4-10-24/h1,3-6,9-16,28H,2,7-8,17-22,31H2,(H,32,35) |
| InChIKey | MLDSVPQPGPRWKR-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|