C36H37N3O3 — CID 118293654
(3S)-2-[(2S)-2-amino-3-(4-phenylmethoxyphenyl)propanoyl]-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]-3,4-dihydro-1H-isoquinoline-3-carboxamide (PubChem CID 118293654) has the molecular formula C36H37N3O3 and a molecular weight of 559.71 g/mol. Its IUPAC name is (3S)-2-[(2S)-2-amino-3-(4-phenylmethoxyphenyl)propanoyl]-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]-3,4-dihydro-1H-isoquinoline-3-carboxamide.
| Compound Name | (3S)-2-[(2S)-2-amino-3-(4-phenylmethoxyphenyl)propanoyl]-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]-3,4-dihydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 118293654 |
| Molecular Formula | C36H37N3O3 |
| Molecular Weight | 559.71 g/mol |
| Exact Mass | 559.28 |
| IUPAC Name | (3S)-2-[(2S)-2-amino-3-(4-phenylmethoxyphenyl)propanoyl]-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]-3,4-dihydro-1H-isoquinoline-3-carboxamide |
| SMILES | N[C@@H](Cc1ccc(OCc2ccccc2)cc1)C(=O)N1Cc2ccccc2C[C@H]1C(=O)N[C@@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C36H37N3O3/c37-32(21-25-17-19-30(20-18-25)42-24-26-9-2-1-3-10-26)36(41)39-23-29-13-5-4-12-28(29)22-34(39)35(40)38-33-16-8-14-27-11-6-7-15-31(27)33/h1-7,9-13,15,17-20,32-34H,8,14,16,21-24,37H2,(H,38,40)/t32-,33+,34-/m0/s1 |
| InChIKey | BKFIWKQPDLTYEI-GMTSZFNJSA-N |
| XLogP | 5.28 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.71 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |