C34H38N4O5 — CID 158660782
2-[(2S)-2-[[(2R)-2-methylbutanoyl]amino]-3-(4-nitrophenyl)propanoyl]-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]-3,4-dihydro-1H-isoquinoline-3-carboxamide (PubChem CID 158660782) has the molecular formula C34H38N4O5 and a molecular weight of 582.70 g/mol. Its IUPAC name is 2-[(2S)-2-[[(2R)-2-methylbutanoyl]amino]-3-(4-nitrophenyl)propanoyl]-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]-3,4-dihydro-1H-isoquinoline-3-carboxamide.
| Compound Name | 2-[(2S)-2-[[(2R)-2-methylbutanoyl]amino]-3-(4-nitrophenyl)propanoyl]-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]-3,4-dihydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 158660782 |
| Molecular Formula | C34H38N4O5 |
| Molecular Weight | 582.70 g/mol |
| Exact Mass | 582.28 |
| IUPAC Name | 2-[(2S)-2-[[(2R)-2-methylbutanoyl]amino]-3-(4-nitrophenyl)propanoyl]-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]-3,4-dihydro-1H-isoquinoline-3-carboxamide |
| SMILES | CC[C@@H](C)C(=O)N[C@@H](Cc1ccc([N+](=O)[O-])cc1)C(=O)N1Cc2ccccc2CC1C(=O)N[C@@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C34H38N4O5/c1-3-22(2)32(39)36-30(19-23-15-17-27(18-16-23)38(42)43)34(41)37-21-26-11-5-4-10-25(26)20-31(37)33(40)35-29-14-8-12-24-9-6-7-13-28(24)29/h4-7,9-11,13,15-18,22,29-31H,3,8,12,14,19-21H2,1-2H3,(H,35,40)(H,36,39)/t22-,29-,30+,31?/m1/s1 |
| InChIKey | ICSQKOSULDCIBV-FRFGLRHYSA-N |
| XLogP | 4.82 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.70 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|